C15H18N2O — CID 117062682
4-methyl-4-propan-2-yl-8-oxatetracyclo[4.3.1.02,5.07,9]decane-3,3-dicarbonitrile (PubChem CID 117062682) has the molecular formula C15H18N2O and a molecular weight of 242.32 g/mol. Its IUPAC name is 4-methyl-4-propan-2-yl-8-oxatetracyclo[4.3.1.02,5.07,9]decane-3,3-dicarbonitrile.
| Compound Name | 4-methyl-4-propan-2-yl-8-oxatetracyclo[4.3.1.02,5.07,9]decane-3,3-dicarbonitrile |
|---|---|
| PubChem CID | 117062682 |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | 4-methyl-4-propan-2-yl-8-oxatetracyclo[4.3.1.02,5.07,9]decane-3,3-dicarbonitrile |
| SMILES | CC(C)C1(C)C2C3CC(C4OC34)C2C1(C#N)C#N |
| InChI | InChI=1S/C15H18N2O/c1-7(2)14(3)10-8-4-9(13-12(8)18-13)11(10)15(14,5-16)6-17/h7-13H,4H2,1-3H3 |
| InChIKey | MIMSNQYNTWDAHQ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 60.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|