C32H40O4S — CID 11706293
(1R,2R,4S)-2-[6-[(1R,2R,4S)-2-hydroxy-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]-5,5-dioxodibenzothiophen-4-yl]-1,3,3-trimethylbicyclo[2.2.1]heptan-2-ol (PubChem CID 11706293) has the molecular formula C32H40O4S and a molecular weight of 520.74 g/mol. Its IUPAC name is (1R,2R,4S)-2-[6-[(1R,2R,4S)-2-hydroxy-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]-5,5-dioxodibenzothiophen-4-yl]-1,3,3-trimethylbicyclo[2.2.1]heptan-2-ol.
| Compound Name | (1R,2R,4S)-2-[6-[(1R,2R,4S)-2-hydroxy-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]-5,5-dioxodibenzothiophen-4-yl]-1,3,3-trimethylbicyclo[2.2.1]heptan-2-ol |
|---|---|
| PubChem CID | 11706293 |
| Molecular Formula | C32H40O4S |
| Molecular Weight | 520.74 g/mol |
| Exact Mass | 520.26 |
| IUPAC Name | (1R,2R,4S)-2-[6-[(1R,2R,4S)-2-hydroxy-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]-5,5-dioxodibenzothiophen-4-yl]-1,3,3-trimethylbicyclo[2.2.1]heptan-2-ol |
| SMILES | CC1(C)[C@H]2CC[C@](C)(C2)[C@]1(O)c1cccc2c1S(=O)(=O)c1c-2cccc1[C@]1(O)C(C)(C)[C@H]2CC[C@]1(C)C2 |
| InChI | InChI=1S/C32H40O4S/c1-27(2)19-13-15-29(5,17-19)31(27,33)23-11-7-9-21-22-10-8-12-24(26(22)37(35,36)25(21)23)32(34)28(3,4)20-14-16-30(32,6)18-20/h7-12,19-20,33-34H,13-18H2,1-6H3/t19-,20-,29+,30+,31-,32-/m0/s1 |
| InChIKey | AKVRBNGQGFVEQI-XFEZTCCASA-N |
| XLogP | 6.57 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.74 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |