C9H5Cl3N2 — CID 117063020
4-chloro-1-(3,5-dichlorophenyl)pyrazole (PubChem CID 117063020) has the molecular formula C9H5Cl3N2 and a molecular weight of 247.51 g/mol. Its IUPAC name is 4-chloro-1-(3,5-dichlorophenyl)pyrazole.
| Compound Name | 4-chloro-1-(3,5-dichlorophenyl)pyrazole |
|---|---|
| PubChem CID | 117063020 |
| Molecular Formula | C9H5Cl3N2 |
| Molecular Weight | 247.51 g/mol |
| Exact Mass | 245.95 |
| IUPAC Name | 4-chloro-1-(3,5-dichlorophenyl)pyrazole |
| SMILES | Clc1cc(Cl)cc(-n2cc(Cl)cn2)c1 |
| InChI | InChI=1S/C9H5Cl3N2/c10-6-1-7(11)3-9(2-6)14-5-8(12)4-13-14/h1-5H |
| InChIKey | KMQGQTSOVBPIMN-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.51 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |