C9H9F5N2O2 — CID 117063772
6-(1,1,2,2,2-pentafluoroethyl)-3-propan-2-yl-1H-pyrimidine-2,4-dione (PubChem CID 117063772) has the molecular formula C9H9F5N2O2 and a molecular weight of 272.17 g/mol. Its IUPAC name is 6-(1,1,2,2,2-pentafluoroethyl)-3-propan-2-yl-1H-pyrimidine-2,4-dione.
| Compound Name | 6-(1,1,2,2,2-pentafluoroethyl)-3-propan-2-yl-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 117063772 |
| Molecular Formula | C9H9F5N2O2 |
| Molecular Weight | 272.17 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 6-(1,1,2,2,2-pentafluoroethyl)-3-propan-2-yl-1H-pyrimidine-2,4-dione |
| SMILES | CC(C)n1c(=O)cc(C(F)(F)C(F)(F)F)[nH]c1=O |
| InChI | InChI=1S/C9H9F5N2O2/c1-4(2)16-6(17)3-5(15-7(16)18)8(10,11)9(12,13)14/h3-4H,1-2H3,(H,15,18) |
| InChIKey | IVYCGBAUIJVLRL-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.17 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|