C8H13F3N2O3S — CID 117063799
1,1,1-trifluoro-N-[3-(2-oxopyrrolidin-1-yl)propyl]methanesulfonamide (PubChem CID 117063799) has the molecular formula C8H13F3N2O3S and a molecular weight of 274.26 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-[3-(2-oxopyrrolidin-1-yl)propyl]methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-[3-(2-oxopyrrolidin-1-yl)propyl]methanesulfonamide |
|---|---|
| PubChem CID | 117063799 |
| Molecular Formula | C8H13F3N2O3S |
| Molecular Weight | 274.26 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 1,1,1-trifluoro-N-[3-(2-oxopyrrolidin-1-yl)propyl]methanesulfonamide |
| SMILES | O=C1CCCN1CCCNS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C8H13F3N2O3S/c9-8(10,11)17(15,16)12-4-2-6-13-5-1-3-7(13)14/h12H,1-6H2 |
| InChIKey | GJFBSRAYXKUHIE-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.26 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|