About CID 117064244
CID 117064244 (PubChem CID 117064244) has the molecular formula C20H38Mg
and a molecular weight of 302.83 g/mol.
Molecular Properties
| Compound Name | CID 117064244 |
| PubChem CID | 117064244 |
| Molecular Formula | C20H38Mg |
| Molecular Weight | 302.83 g/mol |
| Exact Mass | 302.28 |
| IUPAC Name | — |
| SMILES | CC1C(C)C(C)C(C)C1C.C[C]1[C](C)C(C)C(C)C1C.[Mg] |
| InChI | InChI=1S/C10H20.C10H18.Mg/c2*1-6-7(2)9(4)10(5)8(6)3;/h6-10H,1-5H3;6-8H,1-5H3; |
| InChIKey | SZCOLWLJXHXOEU-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 302.83 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 117064244 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 117064244?
The IUPAC name of CID 117064244 (CID 117064244) is not available.
What is the SMILES notation for CID 117064244?
The canonical SMILES for CID 117064244 is CC1C(C)C(C)C(C)C1C.C[C]1[C](C)C(C)C(C)C1C.[Mg].
What is the InChIKey of CID 117064244?
The InChIKey is SZCOLWLJXHXOEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20.C10H18.Mg/c2*1-6-7(2)9(4)10(5)8(6)3;/h6-10H,1-5H3;6-8H,1-5H3;.
What are the key properties of CID 117064244?
CID 117064244 has a molecular weight of 302.83 g/mol, XLogP of 5.90, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 117064244 is sourced from PubChem (CID 117064244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).