C35H40N4O — CID 11706448
1-[4-[2-[(1R,8S)-11-azatricyclo[6.2.1.02,7]undeca-2,4,6-trien-11-yl]ethyl]cyclohexyl]-3-[(2S)-1-cyano-1,1-diphenylpropan-2-yl]urea (PubChem CID 11706448) has the molecular formula C35H40N4O and a molecular weight of 532.73 g/mol. Its IUPAC name is 1-[4-[2-[(1R,8S)-11-azatricyclo[6.2.1.02,7]undeca-2,4,6-trien-11-yl]ethyl]cyclohexyl]-3-[(2S)-1-cyano-1,1-diphenylpropan-2-yl]urea.
| Compound Name | 1-[4-[2-[(1R,8S)-11-azatricyclo[6.2.1.02,7]undeca-2,4,6-trien-11-yl]ethyl]cyclohexyl]-3-[(2S)-1-cyano-1,1-diphenylpropan-2-yl]urea |
|---|---|
| PubChem CID | 11706448 |
| Molecular Formula | C35H40N4O |
| Molecular Weight | 532.73 g/mol |
| Exact Mass | 532.32 |
| IUPAC Name | 1-[4-[2-[(1R,8S)-11-azatricyclo[6.2.1.02,7]undeca-2,4,6-trien-11-yl]ethyl]cyclohexyl]-3-[(2S)-1-cyano-1,1-diphenylpropan-2-yl]urea |
| SMILES | C[C@H](NC(=O)NC1CCC(CCN2[C@@H]3CC[C@H]2c2ccccc23)CC1)C(C#N)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H40N4O/c1-25(35(24-36,27-10-4-2-5-11-27)28-12-6-3-7-13-28)37-34(40)38-29-18-16-26(17-19-29)22-23-39-32-20-21-33(39)31-15-9-8-14-30(31)32/h2-15,25-26,29,32-33H,16-23H2,1H3,(H2,37,38,40)/t25-,26?,29?,32-,33+/m0/s1 |
| InChIKey | JQAJMMUOPIPDFE-PFCYIYNKSA-N |
| XLogP | 7.02 |
| TPSA | 68.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.73 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |