C13H24N2O4 — CID 117064517
(2S)-2-[[(2S)-2-(acetyl(15N)amino)-3-(113C)methyl(1,2,3,4-13C4)butanoyl]amino]-4-(113C)methyl(1,2,3,4,5-13C5)pentanoic acid (PubChem CID 117064517) has the molecular formula C13H24N2O4 and a molecular weight of 284.25 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-(acetyl(15N)amino)-3-(113C)methyl(1,2,3,4-13C4)butanoyl]amino]-4-(113C)methyl(1,2,3,4,5-13C5)pentanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-(acetyl(15N)amino)-3-(113C)methyl(1,2,3,4-13C4)butanoyl]amino]-4-(113C)methyl(1,2,3,4,5-13C5)pentanoic acid |
|---|---|
| PubChem CID | 117064517 |
| Molecular Formula | C13H24N2O4 |
| Molecular Weight | 284.25 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | (2S)-2-[[(2S)-2-(acetyl(15N)amino)-3-(113C)methyl(1,2,3,4-13C4)butanoyl]amino]-4-(113C)methyl(1,2,3,4,5-13C5)pentanoic acid |
| SMILES | CC(=O)[15NH][13C@H]([13C](=O)N[13C@@H]([13CH2][13CH]([13CH3])[13CH3])[13C](=O)O)[13CH]([13CH3])[13CH3] |
| InChI | InChI=1S/C13H24N2O4/c1-7(2)6-10(13(18)19)15-12(17)11(8(3)4)14-9(5)16/h7-8,10-11H,6H2,1-5H3,(H,14,16)(H,15,17)(H,18,19)/t10-,11-/m0/s1/i1+1,2+1,3+1,4+1,6+1,7+1,8+1,10+1,11+1,12+1,13+1,14+1 |
| InChIKey | KXJIASGDDBUKJR-GQTYAUDASA-N |
| XLogP | 0.76 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.25 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |