C5H11NO — CID 117064546
3,3,4,5,5-pentadeuteriopiperidin-4-ol (PubChem CID 117064546) has the molecular formula C5H11NO and a molecular weight of 106.18 g/mol. Its IUPAC name is 3,3,4,5,5-pentadeuteriopiperidin-4-ol.
| Compound Name | 3,3,4,5,5-pentadeuteriopiperidin-4-ol |
|---|---|
| PubChem CID | 117064546 |
| Molecular Formula | C5H11NO |
| Molecular Weight | 106.18 g/mol |
| Exact Mass | 106.12 |
| IUPAC Name | 3,3,4,5,5-pentadeuteriopiperidin-4-ol |
| SMILES | [2H]C1([2H])CNCC([2H])([2H])C1([2H])O |
| InChI | InChI=1S/C5H11NO/c7-5-1-3-6-4-2-5/h5-7H,1-4H2/i1D2,2D2,5D |
| InChIKey | HDOWRFHMPULYOA-QJWYSIDNSA-N |
| XLogP | -0.27 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 106.18 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |