C7H6O4 — CID 117064737
4-hydroxy-4,6-dihydro(2,3,4,5-13C4)furano[3,2-c](2,3,4,5,6-13C5)pyran-2-one (PubChem CID 117064737) has the molecular formula C7H6O4 and a molecular weight of 161.07 g/mol. Its IUPAC name is 4-hydroxy-4,6-dihydro(2,3,4,5-13C4)furano[3,2-c](2,3,4,5,6-13C5)pyran-2-one.
| Compound Name | 4-hydroxy-4,6-dihydro(2,3,4,5-13C4)furano[3,2-c](2,3,4,5,6-13C5)pyran-2-one |
|---|---|
| PubChem CID | 117064737 |
| Molecular Formula | C7H6O4 |
| Molecular Weight | 161.07 g/mol |
| Exact Mass | 161.05 |
| IUPAC Name | 4-hydroxy-4,6-dihydro(2,3,4,5-13C4)furano[3,2-c](2,3,4,5,6-13C5)pyran-2-one |
| SMILES | O=[13C]1[13CH]=[13C]2[13C](=[13CH][13CH2]O[13CH]2O)O1 |
| InChI | InChI=1S/C7H6O4/c8-6-3-4-5(11-6)1-2-10-7(4)9/h1,3,7,9H,2H2/i1+1,2+1,3+1,4+1,5+1,6+1,7+1 |
| InChIKey | ZRWPUFFVAOMMNM-BNUYUSEDSA-N |
| XLogP | -0.30 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.07 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |