C5H12N2 — CID 117064915
2,2,3,3,4,5,5,6,6-nonadeuteriopiperidin-4-amine (PubChem CID 117064915) has the molecular formula C5H12N2 and a molecular weight of 109.22 g/mol. Its IUPAC name is 2,2,3,3,4,5,5,6,6-nonadeuteriopiperidin-4-amine.
| Compound Name | 2,2,3,3,4,5,5,6,6-nonadeuteriopiperidin-4-amine |
|---|---|
| PubChem CID | 117064915 |
| Molecular Formula | C5H12N2 |
| Molecular Weight | 109.22 g/mol |
| Exact Mass | 109.16 |
| IUPAC Name | 2,2,3,3,4,5,5,6,6-nonadeuteriopiperidin-4-amine |
| SMILES | [2H]C1([2H])NC([2H])([2H])C([2H])([2H])C([2H])(N)C1([2H])[2H] |
| InChI | InChI=1S/C5H12N2/c6-5-1-3-7-4-2-5/h5,7H,1-4,6H2/i1D2,2D2,3D2,4D2,5D |
| InChIKey | BCIIMDOZSUCSEN-UHUJFCCWSA-N |
| XLogP | -0.30 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 109.22 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |