C28H40AuClNP — CID 117065234
2-[bis(1-adamantyl)phosphanyl]-N,N-dimethylaniline;chlorogold (PubChem CID 117065234) has the molecular formula C28H40AuClNP and a molecular weight of 654.03 g/mol. Its IUPAC name is 2-[bis(1-adamantyl)phosphanyl]-N,N-dimethylaniline;chlorogold.
| Compound Name | 2-[bis(1-adamantyl)phosphanyl]-N,N-dimethylaniline;chlorogold |
|---|---|
| PubChem CID | 117065234 |
| Molecular Formula | C28H40AuClNP |
| Molecular Weight | 654.03 g/mol |
| Exact Mass | 653.23 |
| IUPAC Name | 2-[bis(1-adamantyl)phosphanyl]-N,N-dimethylaniline;chlorogold |
| SMILES | CN(C)c1ccccc1P(C12CC3CC(CC(C3)C1)C2)C12CC3CC(CC(C3)C1)C2.Cl[Au] |
| InChI | InChI=1S/C28H40NP.Au.ClH/c1-29(2)25-5-3-4-6-26(25)30(27-13-19-7-20(14-27)9-21(8-19)15-27)28-16-22-10-23(17-28)12-24(11-22)18-28;;/h3-6,19-24H,7-18H2,1-2H3;;1H/q;+1;/p-1 |
| InChIKey | JCSJEPVSKVFFRE-UHFFFAOYSA-M |
| XLogP | 7.48 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.03 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|