About acetic acid;4-[2-(tert-butylamino)-1-hydroxyethyl]benzene-1,2-diol
acetic acid;4-[2-(tert-butylamino)-1-hydroxyethyl]benzene-1,2-diol (PubChem CID 117065306) has the molecular formula C14H23NO5
and a molecular weight of 285.34 g/mol. Its IUPAC name is acetic acid;4-[2-(tert-butylamino)-1-hydroxyethyl]benzene-1,2-diol.
Molecular Properties
| Compound Name | acetic acid;4-[2-(tert-butylamino)-1-hydroxyethyl]benzene-1,2-diol |
| PubChem CID | 117065306 |
| Molecular Formula | C14H23NO5 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | acetic acid;4-[2-(tert-butylamino)-1-hydroxyethyl]benzene-1,2-diol |
| SMILES | CC(=O)O.CC(C)(C)NCC(O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C12H19NO3.C2H4O2/c1-12(2,3)13-7-11(16)8-4-5-9(14)10(15)6-8;1-2(3)4/h4-6,11,13-16H,7H2,1-3H3;1H3,(H,3,4) |
| InChIKey | SVYBIDRTCKRNFA-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;4-[2-(tert-butylamino)-1-hydroxyethyl]benzene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;4-[2-(tert-butylamino)-1-hydroxyethyl]benzene-1,2-diol?
The IUPAC name of acetic acid;4-[2-(tert-butylamino)-1-hydroxyethyl]benzene-1,2-diol (CID 117065306) is acetic acid;4-[2-(tert-butylamino)-1-hydroxyethyl]benzene-1,2-diol.
What is the SMILES notation for acetic acid;4-[2-(tert-butylamino)-1-hydroxyethyl]benzene-1,2-diol?
The canonical SMILES for acetic acid;4-[2-(tert-butylamino)-1-hydroxyethyl]benzene-1,2-diol is CC(=O)O.CC(C)(C)NCC(O)c1ccc(O)c(O)c1.
What is the InChIKey of acetic acid;4-[2-(tert-butylamino)-1-hydroxyethyl]benzene-1,2-diol?
The InChIKey is SVYBIDRTCKRNFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO3.C2H4O2/c1-12(2,3)13-7-11(16)8-4-5-9(14)10(15)6-8;1-2(3)4/h4-6,11,13-16H,7H2,1-3H3;1H3,(H,3,4).
What are the key properties of acetic acid;4-[2-(tert-butylamino)-1-hydroxyethyl]benzene-1,2-diol?
acetic acid;4-[2-(tert-butylamino)-1-hydroxyethyl]benzene-1,2-diol has a molecular weight of 285.34 g/mol, XLogP of 1.61, 3 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;4-[2-(tert-butylamino)-1-hydroxyethyl]benzene-1,2-diol is sourced from PubChem (CID 117065306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).