C27H41Cl2FeN2OP — CID 117065460
1-(6-ditert-butylphosphanyloxy-2-pyridinyl)-N-[2,6-di(propan-2-yl)phenyl]ethanimine;dichloroiron (PubChem CID 117065460) has the molecular formula C27H41Cl2FeN2OP and a molecular weight of 567.36 g/mol. Its IUPAC name is 1-(6-ditert-butylphosphanyloxy-2-pyridinyl)-N-[2,6-di(propan-2-yl)phenyl]ethanimine;dichloroiron.
| Compound Name | 1-(6-ditert-butylphosphanyloxy-2-pyridinyl)-N-[2,6-di(propan-2-yl)phenyl]ethanimine;dichloroiron |
|---|---|
| PubChem CID | 117065460 |
| Molecular Formula | C27H41Cl2FeN2OP |
| Molecular Weight | 567.36 g/mol |
| Exact Mass | 566.17 |
| IUPAC Name | 1-(6-ditert-butylphosphanyloxy-2-pyridinyl)-N-[2,6-di(propan-2-yl)phenyl]ethanimine;dichloroiron |
| SMILES | C/C(=N\c1c(C(C)C)cccc1C(C)C)c1cccc(OP(C(C)(C)C)C(C)(C)C)n1.Cl[Fe]Cl |
| InChI | InChI=1S/C27H41N2OP.2ClH.Fe/c1-18(2)21-14-12-15-22(19(3)4)25(21)28-20(5)23-16-13-17-24(29-23)30-31(26(6,7)8)27(9,10)11;;;/h12-19H,1-11H3;2*1H;/q;;;+2/p-2/b28-20+;;; |
| InChIKey | AXNZDVLPGFYUGH-AZRBKALWSA-L |
| XLogP | 10.22 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.36 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|