C4H10O2 — CID 117065518
1,1,2,2-tetradeuterio-1,2-bis(trideuteriomethoxy)ethane (PubChem CID 117065518) has the molecular formula C4H10O2 and a molecular weight of 100.18 g/mol. Its IUPAC name is 1,1,2,2-tetradeuterio-1,2-bis(trideuteriomethoxy)ethane.
| Compound Name | 1,1,2,2-tetradeuterio-1,2-bis(trideuteriomethoxy)ethane |
|---|---|
| PubChem CID | 117065518 |
| Molecular Formula | C4H10O2 |
| Molecular Weight | 100.18 g/mol |
| Exact Mass | 100.13 |
| IUPAC Name | 1,1,2,2-tetradeuterio-1,2-bis(trideuteriomethoxy)ethane |
| SMILES | [2H]C([2H])([2H])OC([2H])([2H])C([2H])([2H])OC([2H])([2H])[2H] |
| InChI | InChI=1S/C4H10O2/c1-5-3-4-6-2/h3-4H2,1-2H3/i1D3,2D3,3D2,4D2 |
| InChIKey | XTHFKEDIFFGKHM-MWUKXHIBSA-N |
| XLogP | 0.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 100.18 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |