C10H16N8 — CID 117065742
5-[[1-(2H-tetrazol-5-yl)cycloheptyl]methyl]-2H-tetrazole (PubChem CID 117065742) has the molecular formula C10H16N8 and a molecular weight of 248.29 g/mol. Its IUPAC name is 5-[[1-(2H-tetrazol-5-yl)cycloheptyl]methyl]-2H-tetrazole.
| Compound Name | 5-[[1-(2H-tetrazol-5-yl)cycloheptyl]methyl]-2H-tetrazole |
|---|---|
| PubChem CID | 117065742 |
| Molecular Formula | C10H16N8 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | 5-[[1-(2H-tetrazol-5-yl)cycloheptyl]methyl]-2H-tetrazole |
| SMILES | C1CCCC(Cc2nn[nH]n2)(c2nn[nH]n2)CC1 |
| InChI | InChI=1S/C10H16N8/c1-2-4-6-10(5-3-1,9-13-17-18-14-9)7-8-11-15-16-12-8/h1-7H2,(H,11,12,15,16)(H,13,14,17,18) |
| InChIKey | RSKYVLJYXBFCLX-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |