C10H14F12N4P2S2 — CID 11706581
6,12-dimethyl-8,10-dithia-1,3-diaza-6,12-diazoniatricyclo[9.3.0.03,7]tetradeca-4,6,11,13-tetraene dihexafluorophosphate (PubChem CID 11706581) has the molecular formula C10H14F12N4P2S2 and a molecular weight of 544.31 g/mol. Its IUPAC name is 6,12-dimethyl-8,10-dithia-1,3-diaza-6,12-diazoniatricyclo[9.3.0.03,7]tetradeca-4,6,11,13-tetraene dihexafluorophosphate.
| Compound Name | 6,12-dimethyl-8,10-dithia-1,3-diaza-6,12-diazoniatricyclo[9.3.0.03,7]tetradeca-4,6,11,13-tetraene dihexafluorophosphate |
|---|---|
| PubChem CID | 11706581 |
| Molecular Formula | C10H14F12N4P2S2 |
| Molecular Weight | 544.31 g/mol |
| Exact Mass | 543.99 |
| IUPAC Name | 6,12-dimethyl-8,10-dithia-1,3-diaza-6,12-diazoniatricyclo[9.3.0.03,7]tetradeca-4,6,11,13-tetraene dihexafluorophosphate |
| SMILES | C[n+]1ccn2c1SCSc1n(cc[n+]1C)C2.F[P-](F)(F)(F)(F)F.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C10H14N4S2.2F6P/c1-11-3-5-13-7-14-6-4-12(2)10(14)16-8-15-9(11)13;2*1-7(2,3,4,5)6/h3-6H,7-8H2,1-2H3;;/q+2;2*-1 |
| InChIKey | PARWVVDRNNWSQJ-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 17.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.31 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|