C20H19NO9 — CID 117066049
(4S,4aS,6S,12aR)-1,4,6,10,11,12a-hexahydroxy-6-methyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide (PubChem CID 117066049) has the molecular formula C20H19NO9 and a molecular weight of 417.37 g/mol. Its IUPAC name is (4S,4aS,6S,12aR)-1,4,6,10,11,12a-hexahydroxy-6-methyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aS,6S,12aR)-1,4,6,10,11,12a-hexahydroxy-6-methyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 117066049 |
| Molecular Formula | C20H19NO9 |
| Molecular Weight | 417.37 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | (4S,4aS,6S,12aR)-1,4,6,10,11,12a-hexahydroxy-6-methyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide |
| SMILES | C[C@@]1(O)c2cccc(O)c2C(O)=C2C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)[C@@H](O)[C@@H]3CC21 |
| InChI | InChI=1S/C20H19NO9/c1-19(29)6-3-2-4-9(22)10(6)14(24)11-7(19)5-8-13(23)15(25)12(18(21)28)17(27)20(8,30)16(11)26/h2-4,7-8,13,22-24,27,29-30H,5H2,1H3,(H2,21,28)/t7?,8-,13-,19+,20-/m0/s1 |
| InChIKey | RRPIKAJGYVMZJN-SBQBIZKYSA-N |
| XLogP | -0.94 |
| TPSA | 198.61 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.37 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|