C25H26INO5 — CID 11706611
2-(4-iodobutyl)-6,7,10,11-tetramethoxyphenanthro[9,10-c]pyridin-1-one (PubChem CID 11706611) has the molecular formula C25H26INO5 and a molecular weight of 547.39 g/mol. Its IUPAC name is 2-(4-iodobutyl)-6,7,10,11-tetramethoxyphenanthro[9,10-c]pyridin-1-one.
| Compound Name | 2-(4-iodobutyl)-6,7,10,11-tetramethoxyphenanthro[9,10-c]pyridin-1-one |
|---|---|
| PubChem CID | 11706611 |
| Molecular Formula | C25H26INO5 |
| Molecular Weight | 547.39 g/mol |
| Exact Mass | 547.09 |
| IUPAC Name | 2-(4-iodobutyl)-6,7,10,11-tetramethoxyphenanthro[9,10-c]pyridin-1-one |
| SMILES | COc1cc2c(cc1OC)c1ccn(CCCCI)c(=O)c1c1cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C25H26INO5/c1-29-20-11-16-15-7-10-27(9-6-5-8-26)25(28)24(15)19-14-23(32-4)22(31-3)13-18(19)17(16)12-21(20)30-2/h7,10-14H,5-6,8-9H2,1-4H3 |
| InChIKey | HFSLJBSLCQVETA-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 58.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.39 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|