C23H28F3N3O7S — CID 11706614
[(3S)-oxolan-3-yl] 4-(hydroxycarbamoyl)-4-[[4-(2,4,6-trifluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]sulfonylmethyl]piperidine-1-carboxylate (PubChem CID 11706614) has the molecular formula C23H28F3N3O7S and a molecular weight of 547.55 g/mol. Its IUPAC name is [(3S)-oxolan-3-yl] 4-(hydroxycarbamoyl)-4-[[4-(2,4,6-trifluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]sulfonylmethyl]piperidine-1-carboxylate.
| Compound Name | [(3S)-oxolan-3-yl] 4-(hydroxycarbamoyl)-4-[[4-(2,4,6-trifluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]sulfonylmethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 11706614 |
| Molecular Formula | C23H28F3N3O7S |
| Molecular Weight | 547.55 g/mol |
| Exact Mass | 547.16 |
| IUPAC Name | [(3S)-oxolan-3-yl] 4-(hydroxycarbamoyl)-4-[[4-(2,4,6-trifluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]sulfonylmethyl]piperidine-1-carboxylate |
| SMILES | O=C(O[C@H]1CCOC1)N1CCC(CS(=O)(=O)N2CC=C(c3c(F)cc(F)cc3F)CC2)(C(=O)NO)CC1 |
| InChI | InChI=1S/C23H28F3N3O7S/c24-16-11-18(25)20(19(26)12-16)15-1-6-29(7-2-15)37(33,34)14-23(21(30)27-32)4-8-28(9-5-23)22(31)36-17-3-10-35-13-17/h1,11-12,17,32H,2-10,13-14H2,(H,27,30)/t17-/m0/s1 |
| InChIKey | MUGWTKOSSVTCGI-KRWDZBQOSA-N |
| XLogP | 2.04 |
| TPSA | 125.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.55 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|