C24H40O4 — CID 117066272
methyl 3-[(3R,12S)-3,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butanoate (PubChem CID 117066272) has the molecular formula C24H40O4 and a molecular weight of 392.58 g/mol. Its IUPAC name is methyl 3-[(3R,12S)-3,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butanoate.
| Compound Name | methyl 3-[(3R,12S)-3,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butanoate |
|---|---|
| PubChem CID | 117066272 |
| Molecular Formula | C24H40O4 |
| Molecular Weight | 392.58 g/mol |
| Exact Mass | 392.29 |
| IUPAC Name | methyl 3-[(3R,12S)-3,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butanoate |
| SMILES | COC(=O)CC(C)C1CCC2C3CCC4C[C@H](O)CCC4(C)C3C[C@H](O)C12C |
| InChI | InChI=1S/C24H40O4/c1-14(11-22(27)28-4)18-7-8-19-17-6-5-15-12-16(25)9-10-23(15,2)20(17)13-21(26)24(18,19)3/h14-21,25-26H,5-13H2,1-4H3/t14?,15?,16-,17?,18?,19?,20?,21+,23?,24?/m1/s1 |
| InChIKey | XXRWVQMDVNTJGY-GPTTVZJUSA-N |
| XLogP | 4.18 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.58 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |