C17H26ClNO2 — CID 117066829
tert-butyl 2-phenyl-2-piperidin-1-ylacetate;hydrochloride (PubChem CID 117066829) has the molecular formula C17H26ClNO2 and a molecular weight of 311.85 g/mol. Its IUPAC name is tert-butyl 2-phenyl-2-piperidin-1-ylacetate;hydrochloride.
| Compound Name | tert-butyl 2-phenyl-2-piperidin-1-ylacetate;hydrochloride |
|---|---|
| PubChem CID | 117066829 |
| Molecular Formula | C17H26ClNO2 |
| Molecular Weight | 311.85 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | tert-butyl 2-phenyl-2-piperidin-1-ylacetate;hydrochloride |
| SMILES | CC(C)(C)OC(=O)C(c1ccccc1)N1CCCCC1.Cl |
| InChI | InChI=1S/C17H25NO2.ClH/c1-17(2,3)20-16(19)15(14-10-6-4-7-11-14)18-12-8-5-9-13-18;/h4,6-7,10-11,15H,5,8-9,12-13H2,1-3H3;1H |
| InChIKey | JZCCQPKDQNTJTG-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.85 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |