C31H26F2N4O4 — CID 11706704
methyl 2-fluoro-6-[3-fluoro-4-[[[3-(5,6,7,8-tetrahydro-1,8-naphthyridine-2-carbonylamino)benzoyl]amino]methyl]phenyl]benzoate (PubChem CID 11706704) has the molecular formula C31H26F2N4O4 and a molecular weight of 556.57 g/mol. Its IUPAC name is methyl 2-fluoro-6-[3-fluoro-4-[[[3-(5,6,7,8-tetrahydro-1,8-naphthyridine-2-carbonylamino)benzoyl]amino]methyl]phenyl]benzoate.
| Compound Name | methyl 2-fluoro-6-[3-fluoro-4-[[[3-(5,6,7,8-tetrahydro-1,8-naphthyridine-2-carbonylamino)benzoyl]amino]methyl]phenyl]benzoate |
|---|---|
| PubChem CID | 11706704 |
| Molecular Formula | C31H26F2N4O4 |
| Molecular Weight | 556.57 g/mol |
| Exact Mass | 556.19 |
| IUPAC Name | methyl 2-fluoro-6-[3-fluoro-4-[[[3-(5,6,7,8-tetrahydro-1,8-naphthyridine-2-carbonylamino)benzoyl]amino]methyl]phenyl]benzoate |
| SMILES | COC(=O)c1c(F)cccc1-c1ccc(CNC(=O)c2cccc(NC(=O)c3ccc4c(n3)NCCC4)c2)c(F)c1 |
| InChI | InChI=1S/C31H26F2N4O4/c1-41-31(40)27-23(8-3-9-24(27)32)19-10-11-21(25(33)16-19)17-35-29(38)20-5-2-7-22(15-20)36-30(39)26-13-12-18-6-4-14-34-28(18)37-26/h2-3,5,7-13,15-16H,4,6,14,17H2,1H3,(H,34,37)(H,35,38)(H,36,39) |
| InChIKey | YCNXRBOZVHNXNG-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.57 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |