About 2-hydroxy-4,6,6-trimethylheptanimidamide
2-hydroxy-4,6,6-trimethylheptanimidamide (PubChem CID 117067178) has the molecular formula C10H22N2O
and a molecular weight of 186.30 g/mol. Its IUPAC name is 2-hydroxy-4,6,6-trimethylheptanimidamide.
Molecular Properties
| Compound Name | 2-hydroxy-4,6,6-trimethylheptanimidamide |
| PubChem CID | 117067178 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | 2-hydroxy-4,6,6-trimethylheptanimidamide |
| SMILES | [H]/N=C(\N)C(O)CC(C)CC(C)(C)C |
| InChI | InChI=1S/C10H22N2O/c1-7(6-10(2,3)4)5-8(13)9(11)12/h7-8,13H,5-6H2,1-4H3,(H3,11,12) |
| InChIKey | XKOYRINHYXCTFX-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 70.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-4,6,6-trimethylheptanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-4,6,6-trimethylheptanimidamide?
The IUPAC name of 2-hydroxy-4,6,6-trimethylheptanimidamide (CID 117067178) is 2-hydroxy-4,6,6-trimethylheptanimidamide.
What is the SMILES notation for 2-hydroxy-4,6,6-trimethylheptanimidamide?
The canonical SMILES for 2-hydroxy-4,6,6-trimethylheptanimidamide is [H]/N=C(\N)C(O)CC(C)CC(C)(C)C.
What is the InChIKey of 2-hydroxy-4,6,6-trimethylheptanimidamide?
The InChIKey is XKOYRINHYXCTFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2O/c1-7(6-10(2,3)4)5-8(13)9(11)12/h7-8,13H,5-6H2,1-4H3,(H3,11,12).
What are the key properties of 2-hydroxy-4,6,6-trimethylheptanimidamide?
2-hydroxy-4,6,6-trimethylheptanimidamide has a molecular weight of 186.30 g/mol, XLogP of 1.75, 4 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-4,6,6-trimethylheptanimidamide is sourced from PubChem (CID 117067178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).