About 4-[2-hydroxy-3-(propan-2-ylamino)propyl]-2,4,5-triphenylpyrazol-3-one
4-[2-hydroxy-3-(propan-2-ylamino)propyl]-2,4,5-triphenylpyrazol-3-one (PubChem CID 117069030) has the molecular formula C27H29N3O2
and a molecular weight of 427.55 g/mol. Its IUPAC name is 4-[2-hydroxy-3-(propan-2-ylamino)propyl]-2,4,5-triphenylpyrazol-3-one.
Molecular Properties
| Compound Name | 4-[2-hydroxy-3-(propan-2-ylamino)propyl]-2,4,5-triphenylpyrazol-3-one |
| PubChem CID | 117069030 |
| Molecular Formula | C27H29N3O2 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | 4-[2-hydroxy-3-(propan-2-ylamino)propyl]-2,4,5-triphenylpyrazol-3-one |
| SMILES | CC(C)NCC(O)CC1(c2ccccc2)C(=O)N(c2ccccc2)N=C1c1ccccc1 |
| InChI | InChI=1S/C27H29N3O2/c1-20(2)28-19-24(31)18-27(22-14-8-4-9-15-22)25(21-12-6-3-7-13-21)29-30(26(27)32)23-16-10-5-11-17-23/h3-17,20,24,28,31H,18-19H2,1-2H3 |
| InChIKey | IIVNNPIJYWKFSK-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[2-hydroxy-3-(propan-2-ylamino)propyl]-2,4,5-triphenylpyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-hydroxy-3-(propan-2-ylamino)propyl]-2,4,5-triphenylpyrazol-3-one?
The IUPAC name of 4-[2-hydroxy-3-(propan-2-ylamino)propyl]-2,4,5-triphenylpyrazol-3-one (CID 117069030) is 4-[2-hydroxy-3-(propan-2-ylamino)propyl]-2,4,5-triphenylpyrazol-3-one.
What is the SMILES notation for 4-[2-hydroxy-3-(propan-2-ylamino)propyl]-2,4,5-triphenylpyrazol-3-one?
The canonical SMILES for 4-[2-hydroxy-3-(propan-2-ylamino)propyl]-2,4,5-triphenylpyrazol-3-one is CC(C)NCC(O)CC1(c2ccccc2)C(=O)N(c2ccccc2)N=C1c1ccccc1.
What is the InChIKey of 4-[2-hydroxy-3-(propan-2-ylamino)propyl]-2,4,5-triphenylpyrazol-3-one?
The InChIKey is IIVNNPIJYWKFSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H29N3O2/c1-20(2)28-19-24(31)18-27(22-14-8-4-9-15-22)25(21-12-6-3-7-13-21)29-30(26(27)32)23-16-10-5-11-17-23/h3-17,20,24,28,31H,18-19H2,1-2H3.
What are the key properties of 4-[2-hydroxy-3-(propan-2-ylamino)propyl]-2,4,5-triphenylpyrazol-3-one?
4-[2-hydroxy-3-(propan-2-ylamino)propyl]-2,4,5-triphenylpyrazol-3-one has a molecular weight of 427.55 g/mol, XLogP of 4.12, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-hydroxy-3-(propan-2-ylamino)propyl]-2,4,5-triphenylpyrazol-3-one is sourced from PubChem (CID 117069030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).