About (4-amino-1,5-dimethylpyrazol-3-yl)-phenylmethanone;hydrochloride
(4-amino-1,5-dimethylpyrazol-3-yl)-phenylmethanone;hydrochloride (PubChem CID 117069035) has the molecular formula C12H14ClN3O
and a molecular weight of 251.72 g/mol. Its IUPAC name is (4-amino-1,5-dimethylpyrazol-3-yl)-phenylmethanone;hydrochloride.
Molecular Properties
| Compound Name | (4-amino-1,5-dimethylpyrazol-3-yl)-phenylmethanone;hydrochloride |
| PubChem CID | 117069035 |
| Molecular Formula | C12H14ClN3O |
| Molecular Weight | 251.72 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | (4-amino-1,5-dimethylpyrazol-3-yl)-phenylmethanone;hydrochloride |
| SMILES | Cc1c(N)c(C(=O)c2ccccc2)nn1C.Cl |
| InChI | InChI=1S/C12H13N3O.ClH/c1-8-10(13)11(14-15(8)2)12(16)9-6-4-3-5-7-9;/h3-7H,13H2,1-2H3;1H |
| InChIKey | KFYUZEXWLSQSCS-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.72 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-amino-1,5-dimethylpyrazol-3-yl)-phenylmethanone;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-amino-1,5-dimethylpyrazol-3-yl)-phenylmethanone;hydrochloride?
The IUPAC name of (4-amino-1,5-dimethylpyrazol-3-yl)-phenylmethanone;hydrochloride (CID 117069035) is (4-amino-1,5-dimethylpyrazol-3-yl)-phenylmethanone;hydrochloride.
What is the SMILES notation for (4-amino-1,5-dimethylpyrazol-3-yl)-phenylmethanone;hydrochloride?
The canonical SMILES for (4-amino-1,5-dimethylpyrazol-3-yl)-phenylmethanone;hydrochloride is Cc1c(N)c(C(=O)c2ccccc2)nn1C.Cl.
What is the InChIKey of (4-amino-1,5-dimethylpyrazol-3-yl)-phenylmethanone;hydrochloride?
The InChIKey is KFYUZEXWLSQSCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3O.ClH/c1-8-10(13)11(14-15(8)2)12(16)9-6-4-3-5-7-9;/h3-7H,13H2,1-2H3;1H.
What are the key properties of (4-amino-1,5-dimethylpyrazol-3-yl)-phenylmethanone;hydrochloride?
(4-amino-1,5-dimethylpyrazol-3-yl)-phenylmethanone;hydrochloride has a molecular weight of 251.72 g/mol, XLogP of 1.96, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-amino-1,5-dimethylpyrazol-3-yl)-phenylmethanone;hydrochloride is sourced from PubChem (CID 117069035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).