About 1-methyl-5-(prop-2-ynoxymethyl)-3,6-dihydro-2H-pyridine;hydrochloride
1-methyl-5-(prop-2-ynoxymethyl)-3,6-dihydro-2H-pyridine;hydrochloride (PubChem CID 117069152) has the molecular formula C10H16ClNO
and a molecular weight of 201.70 g/mol. Its IUPAC name is 1-methyl-5-(prop-2-ynoxymethyl)-3,6-dihydro-2H-pyridine;hydrochloride.
Molecular Properties
| Compound Name | 1-methyl-5-(prop-2-ynoxymethyl)-3,6-dihydro-2H-pyridine;hydrochloride |
| PubChem CID | 117069152 |
| Molecular Formula | C10H16ClNO |
| Molecular Weight | 201.70 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | 1-methyl-5-(prop-2-ynoxymethyl)-3,6-dihydro-2H-pyridine;hydrochloride |
| SMILES | C#CCOCC1=CCCN(C)C1.Cl |
| InChI | InChI=1S/C10H15NO.ClH/c1-3-7-12-9-10-5-4-6-11(2)8-10;/h1,5H,4,6-9H2,2H3;1H |
| InChIKey | WIVGBUJFDBOZLK-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.70 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-5-(prop-2-ynoxymethyl)-3,6-dihydro-2H-pyridine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-5-(prop-2-ynoxymethyl)-3,6-dihydro-2H-pyridine;hydrochloride?
The IUPAC name of 1-methyl-5-(prop-2-ynoxymethyl)-3,6-dihydro-2H-pyridine;hydrochloride (CID 117069152) is 1-methyl-5-(prop-2-ynoxymethyl)-3,6-dihydro-2H-pyridine;hydrochloride.
What is the SMILES notation for 1-methyl-5-(prop-2-ynoxymethyl)-3,6-dihydro-2H-pyridine;hydrochloride?
The canonical SMILES for 1-methyl-5-(prop-2-ynoxymethyl)-3,6-dihydro-2H-pyridine;hydrochloride is C#CCOCC1=CCCN(C)C1.Cl.
What is the InChIKey of 1-methyl-5-(prop-2-ynoxymethyl)-3,6-dihydro-2H-pyridine;hydrochloride?
The InChIKey is WIVGBUJFDBOZLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO.ClH/c1-3-7-12-9-10-5-4-6-11(2)8-10;/h1,5H,4,6-9H2,2H3;1H.
What are the key properties of 1-methyl-5-(prop-2-ynoxymethyl)-3,6-dihydro-2H-pyridine;hydrochloride?
1-methyl-5-(prop-2-ynoxymethyl)-3,6-dihydro-2H-pyridine;hydrochloride has a molecular weight of 201.70 g/mol, XLogP of 1.32, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-5-(prop-2-ynoxymethyl)-3,6-dihydro-2H-pyridine;hydrochloride is sourced from PubChem (CID 117069152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).