C12H10F4N2 — CID 117069478
(Z)-(3,4,5,6-tetrafluoro-9-tricyclo[6.2.2.02,7]dodeca-2(7),3,5-trienylidene)hydrazine (PubChem CID 117069478) has the molecular formula C12H10F4N2 and a molecular weight of 258.22 g/mol. Its IUPAC name is (Z)-(3,4,5,6-tetrafluoro-9-tricyclo[6.2.2.02,7]dodeca-2(7),3,5-trienylidene)hydrazine.
| Compound Name | (Z)-(3,4,5,6-tetrafluoro-9-tricyclo[6.2.2.02,7]dodeca-2(7),3,5-trienylidene)hydrazine |
|---|---|
| PubChem CID | 117069478 |
| Molecular Formula | C12H10F4N2 |
| Molecular Weight | 258.22 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | (Z)-(3,4,5,6-tetrafluoro-9-tricyclo[6.2.2.02,7]dodeca-2(7),3,5-trienylidene)hydrazine |
| SMILES | N/N=C1/CC2CCC1c1c(F)c(F)c(F)c(F)c12 |
| InChI | InChI=1S/C12H10F4N2/c13-9-7-4-1-2-5(6(3-4)18-17)8(7)10(14)12(16)11(9)15/h4-5H,1-3,17H2/b18-6- |
| InChIKey | JZJYWYFCRKVDJU-FXBPXSCXSA-N |
| XLogP | 2.92 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.22 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|