About [1-[(7,9-dimethyl-1,4-dioxaspiro[4.5]decan-8-ylidene)methyl]cyclopropyl]-trimethylsilane
[1-[(7,9-dimethyl-1,4-dioxaspiro[4.5]decan-8-ylidene)methyl]cyclopropyl]-trimethylsilane (PubChem CID 117069572) has the molecular formula C17H30O2Si
and a molecular weight of 294.51 g/mol. Its IUPAC name is [1-[(7,9-dimethyl-1,4-dioxaspiro[4.5]decan-8-ylidene)methyl]cyclopropyl]-trimethylsilane.
Molecular Properties
| Compound Name | [1-[(7,9-dimethyl-1,4-dioxaspiro[4.5]decan-8-ylidene)methyl]cyclopropyl]-trimethylsilane |
| PubChem CID | 117069572 |
| Molecular Formula | C17H30O2Si |
| Molecular Weight | 294.51 g/mol |
| Exact Mass | 294.20 |
| IUPAC Name | [1-[(7,9-dimethyl-1,4-dioxaspiro[4.5]decan-8-ylidene)methyl]cyclopropyl]-trimethylsilane |
| SMILES | CC1CC2(CC(C)C1=CC1([Si](C)(C)C)CC1)OCCO2 |
| InChI | InChI=1S/C17H30O2Si/c1-13-10-17(18-8-9-19-17)11-14(2)15(13)12-16(6-7-16)20(3,4)5/h12-14H,6-11H2,1-5H3 |
| InChIKey | OSWRMIOOUYBUEL-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.51 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [1-[(7,9-dimethyl-1,4-dioxaspiro[4.5]decan-8-ylidene)methyl]cyclopropyl]-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(7,9-dimethyl-1,4-dioxaspiro[4.5]decan-8-ylidene)methyl]cyclopropyl]-trimethylsilane?
The IUPAC name of [1-[(7,9-dimethyl-1,4-dioxaspiro[4.5]decan-8-ylidene)methyl]cyclopropyl]-trimethylsilane (CID 117069572) is [1-[(7,9-dimethyl-1,4-dioxaspiro[4.5]decan-8-ylidene)methyl]cyclopropyl]-trimethylsilane.
What is the SMILES notation for [1-[(7,9-dimethyl-1,4-dioxaspiro[4.5]decan-8-ylidene)methyl]cyclopropyl]-trimethylsilane?
The canonical SMILES for [1-[(7,9-dimethyl-1,4-dioxaspiro[4.5]decan-8-ylidene)methyl]cyclopropyl]-trimethylsilane is CC1CC2(CC(C)C1=CC1([Si](C)(C)C)CC1)OCCO2.
What is the InChIKey of [1-[(7,9-dimethyl-1,4-dioxaspiro[4.5]decan-8-ylidene)methyl]cyclopropyl]-trimethylsilane?
The InChIKey is OSWRMIOOUYBUEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30O2Si/c1-13-10-17(18-8-9-19-17)11-14(2)15(13)12-16(6-7-16)20(3,4)5/h12-14H,6-11H2,1-5H3.
What are the key properties of [1-[(7,9-dimethyl-1,4-dioxaspiro[4.5]decan-8-ylidene)methyl]cyclopropyl]-trimethylsilane?
[1-[(7,9-dimethyl-1,4-dioxaspiro[4.5]decan-8-ylidene)methyl]cyclopropyl]-trimethylsilane has a molecular weight of 294.51 g/mol, XLogP of 4.59, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(7,9-dimethyl-1,4-dioxaspiro[4.5]decan-8-ylidene)methyl]cyclopropyl]-trimethylsilane is sourced from PubChem (CID 117069572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).