C21H36O3Si — CID 117069654
(3R,4S)-14-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-3-methyltricyclo[7.4.1.01,6]tetradec-5-en-12-one (PubChem CID 117069654) has the molecular formula C21H36O3Si and a molecular weight of 364.60 g/mol. Its IUPAC name is (3R,4S)-14-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-3-methyltricyclo[7.4.1.01,6]tetradec-5-en-12-one.
| Compound Name | (3R,4S)-14-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-3-methyltricyclo[7.4.1.01,6]tetradec-5-en-12-one |
|---|---|
| PubChem CID | 117069654 |
| Molecular Formula | C21H36O3Si |
| Molecular Weight | 364.60 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | (3R,4S)-14-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-3-methyltricyclo[7.4.1.01,6]tetradec-5-en-12-one |
| SMILES | C[C@@H]1CC23CC(=O)CCC(CCC2=C[C@H]1O)C3O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H36O3Si/c1-14-12-21-13-17(22)10-8-15(7-9-16(21)11-18(14)23)19(21)24-25(5,6)20(2,3)4/h11,14-15,18-19,23H,7-10,12-13H2,1-6H3/t14-,15?,18-,19?,21?/m1/s1 |
| InChIKey | PZVSFGBNMDXBFH-PFSCGADYSA-N |
| XLogP | 4.85 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.60 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|