C21H38O2Si — CID 117069988
(3R,4S)-14-[tert-butyl(dimethyl)silyl]oxy-3-methyltricyclo[7.4.1.01,5]tetradec-5-en-4-ol (PubChem CID 117069988) has the molecular formula C21H38O2Si and a molecular weight of 350.62 g/mol. Its IUPAC name is (3R,4S)-14-[tert-butyl(dimethyl)silyl]oxy-3-methyltricyclo[7.4.1.01,5]tetradec-5-en-4-ol.
| Compound Name | (3R,4S)-14-[tert-butyl(dimethyl)silyl]oxy-3-methyltricyclo[7.4.1.01,5]tetradec-5-en-4-ol |
|---|---|
| PubChem CID | 117069988 |
| Molecular Formula | C21H38O2Si |
| Molecular Weight | 350.62 g/mol |
| Exact Mass | 350.26 |
| IUPAC Name | (3R,4S)-14-[tert-butyl(dimethyl)silyl]oxy-3-methyltricyclo[7.4.1.01,5]tetradec-5-en-4-ol |
| SMILES | C[C@@H]1CC23CCCCC(CCC=C2[C@H]1O)C3O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H38O2Si/c1-15-14-21-13-8-7-10-16(11-9-12-17(21)18(15)22)19(21)23-24(5,6)20(2,3)4/h12,15-16,18-19,22H,7-11,13-14H2,1-6H3/t15-,16?,18+,19?,21?/m1/s1 |
| InChIKey | VPDAVBUXKAGDQF-DQBJTJSTSA-N |
| XLogP | 5.67 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.62 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|