C28H42O4SSi — CID 117069989
(3R,4S,8R,9S)-17-[tert-butyl(dimethyl)silyl]oxy-3-methyl-9-phenylsulfanyl-5,7-dioxatetracyclo[10.4.1.01,8.04,8]heptadecan-6-one (PubChem CID 117069989) has the molecular formula C28H42O4SSi and a molecular weight of 502.79 g/mol. Its IUPAC name is (3R,4S,8R,9S)-17-[tert-butyl(dimethyl)silyl]oxy-3-methyl-9-phenylsulfanyl-5,7-dioxatetracyclo[10.4.1.01,8.04,8]heptadecan-6-one.
| Compound Name | (3R,4S,8R,9S)-17-[tert-butyl(dimethyl)silyl]oxy-3-methyl-9-phenylsulfanyl-5,7-dioxatetracyclo[10.4.1.01,8.04,8]heptadecan-6-one |
|---|---|
| PubChem CID | 117069989 |
| Molecular Formula | C28H42O4SSi |
| Molecular Weight | 502.79 g/mol |
| Exact Mass | 502.26 |
| IUPAC Name | (3R,4S,8R,9S)-17-[tert-butyl(dimethyl)silyl]oxy-3-methyl-9-phenylsulfanyl-5,7-dioxatetracyclo[10.4.1.01,8.04,8]heptadecan-6-one |
| SMILES | C[C@@H]1CC23CCCCC(CC[C@H](Sc4ccccc4)[C@@]24OC(=O)O[C@@H]14)C3O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H42O4SSi/c1-19-18-27-17-11-10-12-20(24(27)32-34(5,6)26(2,3)4)15-16-22(33-21-13-8-7-9-14-21)28(27)23(19)30-25(29)31-28/h7-9,13-14,19-20,22-24H,10-12,15-18H2,1-6H3/t19-,20?,22+,23+,24?,27?,28+/m1/s1 |
| InChIKey | LEZFYSUTHOGAGN-GSFGIHSQSA-N |
| XLogP | 7.82 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.79 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|