C21H34O2S2Si — CID 117070022
1'-[tert-butyl(dimethyl)silyl]oxyspiro[1,3-dithiane-2,4'-2,3,3a,5,5a,6-hexahydro-1H-cyclopenta[i]indene]-7'-one (PubChem CID 117070022) has the molecular formula C21H34O2S2Si and a molecular weight of 410.72 g/mol. Its IUPAC name is 1'-[tert-butyl(dimethyl)silyl]oxyspiro[1,3-dithiane-2,4'-2,3,3a,5,5a,6-hexahydro-1H-cyclopenta[i]indene]-7'-one.
| Compound Name | 1'-[tert-butyl(dimethyl)silyl]oxyspiro[1,3-dithiane-2,4'-2,3,3a,5,5a,6-hexahydro-1H-cyclopenta[i]indene]-7'-one |
|---|---|
| PubChem CID | 117070022 |
| Molecular Formula | C21H34O2S2Si |
| Molecular Weight | 410.72 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 1'-[tert-butyl(dimethyl)silyl]oxyspiro[1,3-dithiane-2,4'-2,3,3a,5,5a,6-hexahydro-1H-cyclopenta[i]indene]-7'-one |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCC2C3(CC4CC(=O)C=CC412)SCCCS3 |
| InChI | InChI=1S/C21H34O2S2Si/c1-19(2,3)26(4,5)23-18-8-7-17-20(18)10-9-16(22)13-15(20)14-21(17)24-11-6-12-25-21/h9-10,15,17-18H,6-8,11-14H2,1-5H3 |
| InChIKey | QUKTZKHOTCXQTE-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.72 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|