C17H34O3Si — CID 117070174
2-[[(E,6S)-2,6-dimethyl-7-(oxiran-2-yl)hept-2-enoxy]methoxy]ethyl-trimethylsilane (PubChem CID 117070174) has the molecular formula C17H34O3Si and a molecular weight of 314.54 g/mol. Its IUPAC name is 2-[[(E,6S)-2,6-dimethyl-7-(oxiran-2-yl)hept-2-enoxy]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[(E,6S)-2,6-dimethyl-7-(oxiran-2-yl)hept-2-enoxy]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 117070174 |
| Molecular Formula | C17H34O3Si |
| Molecular Weight | 314.54 g/mol |
| Exact Mass | 314.23 |
| IUPAC Name | 2-[[(E,6S)-2,6-dimethyl-7-(oxiran-2-yl)hept-2-enoxy]methoxy]ethyl-trimethylsilane |
| SMILES | C/C(=C\CC[C@H](C)CC1CO1)COCOCC[Si](C)(C)C |
| InChI | InChI=1S/C17H34O3Si/c1-15(11-17-13-20-17)7-6-8-16(2)12-19-14-18-9-10-21(3,4)5/h8,15,17H,6-7,9-14H2,1-5H3/b16-8+/t15-,17?/m0/s1 |
| InChIKey | UAIJYSHDLDJVQF-XBNRNGFZSA-N |
| XLogP | 4.47 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.54 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|