C19H22O6S — CID 117070178
(2'-methyl-3'-oxospiro[1,3-dioxolane-2,7'-bicyclo[2.2.2]oct-5-ene]-2'-yl)methyl 4-methylbenzenesulfonate (PubChem CID 117070178) has the molecular formula C19H22O6S and a molecular weight of 378.45 g/mol. Its IUPAC name is (2'-methyl-3'-oxospiro[1,3-dioxolane-2,7'-bicyclo[2.2.2]oct-5-ene]-2'-yl)methyl 4-methylbenzenesulfonate.
| Compound Name | (2'-methyl-3'-oxospiro[1,3-dioxolane-2,7'-bicyclo[2.2.2]oct-5-ene]-2'-yl)methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 117070178 |
| Molecular Formula | C19H22O6S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | (2'-methyl-3'-oxospiro[1,3-dioxolane-2,7'-bicyclo[2.2.2]oct-5-ene]-2'-yl)methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2(C)C(=O)C3C=CC2C2(C3)OCCO2)cc1 |
| InChI | InChI=1S/C19H22O6S/c1-13-3-6-15(7-4-13)26(21,22)25-12-18(2)16-8-5-14(17(18)20)11-19(16)23-9-10-24-19/h3-8,14,16H,9-12H2,1-2H3 |
| InChIKey | QJHIOOJNIKUTIG-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|