C25H44O6Si — CID 117070239
(1R,2S,4S,9R,10R)-13-methoxy-4,10,15,15-tetramethyl-2-(2-trimethylsilylethoxymethoxy)-5,16-dioxatetracyclo[11.2.1.01,10.04,9]hexadecan-6-one (PubChem CID 117070239) has the molecular formula C25H44O6Si and a molecular weight of 468.71 g/mol. Its IUPAC name is (1R,2S,4S,9R,10R)-13-methoxy-4,10,15,15-tetramethyl-2-(2-trimethylsilylethoxymethoxy)-5,16-dioxatetracyclo[11.2.1.01,10.04,9]hexadecan-6-one.
| Compound Name | (1R,2S,4S,9R,10R)-13-methoxy-4,10,15,15-tetramethyl-2-(2-trimethylsilylethoxymethoxy)-5,16-dioxatetracyclo[11.2.1.01,10.04,9]hexadecan-6-one |
|---|---|
| PubChem CID | 117070239 |
| Molecular Formula | C25H44O6Si |
| Molecular Weight | 468.71 g/mol |
| Exact Mass | 468.29 |
| IUPAC Name | (1R,2S,4S,9R,10R)-13-methoxy-4,10,15,15-tetramethyl-2-(2-trimethylsilylethoxymethoxy)-5,16-dioxatetracyclo[11.2.1.01,10.04,9]hexadecan-6-one |
| SMILES | COC12CC[C@]3(C)[C@H]4CCC(=O)O[C@@]4(C)C[C@H](OCOCC[Si](C)(C)C)[C@@]3(O1)C(C)(C)C2 |
| InChI | InChI=1S/C25H44O6Si/c1-21(2)16-24(27-5)12-11-22(3)18-9-10-20(26)30-23(18,4)15-19(25(21,22)31-24)29-17-28-13-14-32(6,7)8/h18-19H,9-17H2,1-8H3/t18-,19+,22-,23+,24?,25-/m1/s1 |
| InChIKey | DZQVALKWOQOEHR-IZQIVRDBSA-N |
| XLogP | 5.13 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.71 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|