C28H26NO5P — CID 117070657
methyl 5-[2-cyano-2-(triphenyl-λ5-phosphanylidene)acetyl]-2,2-dimethyl-1,3-dioxolane-4-carboxylate (PubChem CID 117070657) has the molecular formula C28H26NO5P and a molecular weight of 487.49 g/mol. Its IUPAC name is methyl 5-[2-cyano-2-(triphenyl-λ5-phosphanylidene)acetyl]-2,2-dimethyl-1,3-dioxolane-4-carboxylate.
| Compound Name | methyl 5-[2-cyano-2-(triphenyl-λ5-phosphanylidene)acetyl]-2,2-dimethyl-1,3-dioxolane-4-carboxylate |
|---|---|
| PubChem CID | 117070657 |
| Molecular Formula | C28H26NO5P |
| Molecular Weight | 487.49 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | methyl 5-[2-cyano-2-(triphenyl-λ5-phosphanylidene)acetyl]-2,2-dimethyl-1,3-dioxolane-4-carboxylate |
| SMILES | COC(=O)C1OC(C)(C)OC1C(=O)C(C#N)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H26NO5P/c1-28(2)33-25(26(34-28)27(31)32-3)24(30)23(19-29)35(20-13-7-4-8-14-20,21-15-9-5-10-16-21)22-17-11-6-12-18-22/h4-18,25-26H,1-3H3 |
| InChIKey | YKHKJDLJSRXRKT-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 85.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.49 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|