C36H64O5Si2 — CID 117070742
(1S,2R,5S,7R,9R,10S,14R,15S,19S)-7,15-bis[[tert-butyl(dimethyl)silyl]oxy]-19-ethyl-14-methyl-20-oxatetracyclo[10.10.0.02,10.05,9]docos-3-ene-13,21-dione (PubChem CID 117070742) has the molecular formula C36H64O5Si2 and a molecular weight of 633.08 g/mol. Its IUPAC name is (1S,2R,5S,7R,9R,10S,14R,15S,19S)-7,15-bis[[tert-butyl(dimethyl)silyl]oxy]-19-ethyl-14-methyl-20-oxatetracyclo[10.10.0.02,10.05,9]docos-3-ene-13,21-dione.
| Compound Name | (1S,2R,5S,7R,9R,10S,14R,15S,19S)-7,15-bis[[tert-butyl(dimethyl)silyl]oxy]-19-ethyl-14-methyl-20-oxatetracyclo[10.10.0.02,10.05,9]docos-3-ene-13,21-dione |
|---|---|
| PubChem CID | 117070742 |
| Molecular Formula | C36H64O5Si2 |
| Molecular Weight | 633.08 g/mol |
| Exact Mass | 632.43 |
| IUPAC Name | (1S,2R,5S,7R,9R,10S,14R,15S,19S)-7,15-bis[[tert-butyl(dimethyl)silyl]oxy]-19-ethyl-14-methyl-20-oxatetracyclo[10.10.0.02,10.05,9]docos-3-ene-13,21-dione |
| SMILES | CC[C@H]1CCC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)C2C[C@@H]3[C@@H](C=C[C@@H]4C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H]34)[C@@H]2CC(=O)O1 |
| InChI | InChI=1S/C36H64O5Si2/c1-13-25-15-14-16-32(41-43(11,12)36(6,7)8)23(2)34(38)31-21-29-27(30(31)22-33(37)39-25)18-17-24-19-26(20-28(24)29)40-42(9,10)35(3,4)5/h17-18,23-32H,13-16,19-22H2,1-12H3/t23-,24-,25+,26-,27-,28-,29-,30+,31?,32+/m1/s1 |
| InChIKey | IKIWWBOZZMRCCH-QKZMMNKCSA-N |
| XLogP | 9.33 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.08 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|