C10H16O5 — CID 117070957
(4aR,7R,8R)-8-hydroxy-2,2,7-trimethyl-4a,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-6-one (PubChem CID 117070957) has the molecular formula C10H16O5 and a molecular weight of 216.23 g/mol. Its IUPAC name is (4aR,7R,8R)-8-hydroxy-2,2,7-trimethyl-4a,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-6-one.
| Compound Name | (4aR,7R,8R)-8-hydroxy-2,2,7-trimethyl-4a,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-6-one |
|---|---|
| PubChem CID | 117070957 |
| Molecular Formula | C10H16O5 |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | (4aR,7R,8R)-8-hydroxy-2,2,7-trimethyl-4a,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-6-one |
| SMILES | C[C@H]1C(=O)O[C@@H]2COC(C)(C)OC2[C@@H]1O |
| InChI | InChI=1S/C10H16O5/c1-5-7(11)8-6(14-9(5)12)4-13-10(2,3)15-8/h5-8,11H,4H2,1-3H3/t5-,6-,7-,8?/m1/s1 |
| InChIKey | LBDMDUPRHDGQHC-XDTPYFJJSA-N |
| XLogP | 0.06 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |