C27H20O3 — CID 117070988
(2S,6S,7R)-1,8-diphenylspiro[15-oxatetracyclo[6.6.1.02,7.09,14]pentadeca-4,9,11,13-tetraene-6,2'-oxirane]-3-one (PubChem CID 117070988) has the molecular formula C27H20O3 and a molecular weight of 392.45 g/mol. Its IUPAC name is (2S,6S,7R)-1,8-diphenylspiro[15-oxatetracyclo[6.6.1.02,7.09,14]pentadeca-4,9,11,13-tetraene-6,2'-oxirane]-3-one.
| Compound Name | (2S,6S,7R)-1,8-diphenylspiro[15-oxatetracyclo[6.6.1.02,7.09,14]pentadeca-4,9,11,13-tetraene-6,2'-oxirane]-3-one |
|---|---|
| PubChem CID | 117070988 |
| Molecular Formula | C27H20O3 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | (2S,6S,7R)-1,8-diphenylspiro[15-oxatetracyclo[6.6.1.02,7.09,14]pentadeca-4,9,11,13-tetraene-6,2'-oxirane]-3-one |
| SMILES | O=C1C=C[C@@]2(CO2)[C@@H]2[C@H]1C1(c3ccccc3)OC2(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C27H20O3/c28-22-15-16-25(17-29-25)24-23(22)26(18-9-3-1-4-10-18)20-13-7-8-14-21(20)27(24,30-26)19-11-5-2-6-12-19/h1-16,23-24H,17H2/t23-,24-,25+,26?,27?/m0/s1 |
| InChIKey | YZPLLVYCVKFPKP-RVMAVILXSA-N |
| XLogP | 4.36 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|