C14H26O5Si — CID 117070993
(3R,4S,9S)-9-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydroxy-1-oxaspiro[4.4]nonan-2-one (PubChem CID 117070993) has the molecular formula C14H26O5Si and a molecular weight of 302.44 g/mol. Its IUPAC name is (3R,4S,9S)-9-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydroxy-1-oxaspiro[4.4]nonan-2-one.
| Compound Name | (3R,4S,9S)-9-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydroxy-1-oxaspiro[4.4]nonan-2-one |
|---|---|
| PubChem CID | 117070993 |
| Molecular Formula | C14H26O5Si |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | (3R,4S,9S)-9-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydroxy-1-oxaspiro[4.4]nonan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CCCC12OC(=O)[C@H](O)[C@@H]2O |
| InChI | InChI=1S/C14H26O5Si/c1-13(2,3)20(4,5)19-9-7-6-8-14(9)11(16)10(15)12(17)18-14/h9-11,15-16H,6-8H2,1-5H3/t9-,10+,11-,14?/m0/s1 |
| InChIKey | LKALNZYNNDLHEO-JSIFYMHPSA-N |
| XLogP | 1.58 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|