C30H36N2O12 — CID 11707114
[(2R,3S,4R,5R,6R)-3,4-diacetyloxy-5-(phenylmethoxycarbonylamino)-6-[2-(phenylmethoxycarbonylamino)ethoxy]oxan-2-yl]methyl acetate (PubChem CID 11707114) has the molecular formula C30H36N2O12 and a molecular weight of 616.62 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-3,4-diacetyloxy-5-(phenylmethoxycarbonylamino)-6-[2-(phenylmethoxycarbonylamino)ethoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6R)-3,4-diacetyloxy-5-(phenylmethoxycarbonylamino)-6-[2-(phenylmethoxycarbonylamino)ethoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11707114 |
| Molecular Formula | C30H36N2O12 |
| Molecular Weight | 616.62 g/mol |
| Exact Mass | 616.23 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-3,4-diacetyloxy-5-(phenylmethoxycarbonylamino)-6-[2-(phenylmethoxycarbonylamino)ethoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](OCCNC(=O)OCc2ccccc2)[C@H](NC(=O)OCc2ccccc2)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C30H36N2O12/c1-19(33)39-18-24-26(42-20(2)34)27(43-21(3)35)25(32-30(37)41-17-23-12-8-5-9-13-23)28(44-24)38-15-14-31-29(36)40-16-22-10-6-4-7-11-22/h4-13,24-28H,14-18H2,1-3H3,(H,31,36)(H,32,37)/t24-,25-,26-,27-,28-/m1/s1 |
| InChIKey | MQIHDTULLUWCBI-JQPIIJRMSA-N |
| XLogP | 2.38 |
| TPSA | 174.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.62 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|