About [4-[3,5-bis(4-benzoylphenyl)phenyl]phenyl]-phenylmethanone
[4-[3,5-bis(4-benzoylphenyl)phenyl]phenyl]-phenylmethanone (PubChem CID 11707128) has the molecular formula C45H30O3
and a molecular weight of 618.73 g/mol. Its IUPAC name is [4-[3,5-bis(4-benzoylphenyl)phenyl]phenyl]-phenylmethanone.
Molecular Properties
| Compound Name | [4-[3,5-bis(4-benzoylphenyl)phenyl]phenyl]-phenylmethanone |
| PubChem CID | 11707128 |
| Molecular Formula | C45H30O3 |
| Molecular Weight | 618.73 g/mol |
| Exact Mass | 618.22 |
| IUPAC Name | [4-[3,5-bis(4-benzoylphenyl)phenyl]phenyl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1ccc(-c2cc(-c3ccc(C(=O)c4ccccc4)cc3)cc(-c3ccc(C(=O)c4ccccc4)cc3)c2)cc1 |
| InChI | InChI=1S/C45H30O3/c46-43(34-10-4-1-5-11-34)37-22-16-31(17-23-37)40-28-41(32-18-24-38(25-19-32)44(47)35-12-6-2-7-13-35)30-42(29-40)33-20-26-39(27-21-33)45(48)36-14-8-3-9-15-36/h1-30H |
| InChIKey | WOOBPQGYVSIZEF-UHFFFAOYSA-N |
| XLogP | 10.38 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 618.73 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-[3,5-bis(4-benzoylphenyl)phenyl]phenyl]-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[3,5-bis(4-benzoylphenyl)phenyl]phenyl]-phenylmethanone?
The IUPAC name of [4-[3,5-bis(4-benzoylphenyl)phenyl]phenyl]-phenylmethanone (CID 11707128) is [4-[3,5-bis(4-benzoylphenyl)phenyl]phenyl]-phenylmethanone.
What is the SMILES notation for [4-[3,5-bis(4-benzoylphenyl)phenyl]phenyl]-phenylmethanone?
The canonical SMILES for [4-[3,5-bis(4-benzoylphenyl)phenyl]phenyl]-phenylmethanone is O=C(c1ccccc1)c1ccc(-c2cc(-c3ccc(C(=O)c4ccccc4)cc3)cc(-c3ccc(C(=O)c4ccccc4)cc3)c2)cc1.
What is the InChIKey of [4-[3,5-bis(4-benzoylphenyl)phenyl]phenyl]-phenylmethanone?
The InChIKey is WOOBPQGYVSIZEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C45H30O3/c46-43(34-10-4-1-5-11-34)37-22-16-31(17-23-37)40-28-41(32-18-24-38(25-19-32)44(47)35-12-6-2-7-13-35)30-42(29-40)33-20-26-39(27-21-33)45(48)36-14-8-3-9-15-36/h1-30H.
What are the key properties of [4-[3,5-bis(4-benzoylphenyl)phenyl]phenyl]-phenylmethanone?
[4-[3,5-bis(4-benzoylphenyl)phenyl]phenyl]-phenylmethanone has a molecular weight of 618.73 g/mol, XLogP of 10.38, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[3,5-bis(4-benzoylphenyl)phenyl]phenyl]-phenylmethanone is sourced from PubChem (CID 11707128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).