C37H38N4O5 — CID 11707129
(E)-3-[4-[[1-[(18-cyclohexyl-8-oxa-3,11-diazatetracyclo[9.7.0.02,7.012,17]octadeca-1(18),2(7),3,5,12(17),13,15-heptaene-14-carbonyl)amino]cyclopentanecarbonyl]amino]phenyl]prop-2-enoic acid (PubChem CID 11707129) has the molecular formula C37H38N4O5 and a molecular weight of 618.73 g/mol. Its IUPAC name is (E)-3-[4-[[1-[(18-cyclohexyl-8-oxa-3,11-diazatetracyclo[9.7.0.02,7.012,17]octadeca-1(18),2(7),3,5,12(17),13,15-heptaene-14-carbonyl)amino]cyclopentanecarbonyl]amino]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[[1-[(18-cyclohexyl-8-oxa-3,11-diazatetracyclo[9.7.0.02,7.012,17]octadeca-1(18),2(7),3,5,12(17),13,15-heptaene-14-carbonyl)amino]cyclopentanecarbonyl]amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 11707129 |
| Molecular Formula | C37H38N4O5 |
| Molecular Weight | 618.73 g/mol |
| Exact Mass | 618.28 |
| IUPAC Name | (E)-3-[4-[[1-[(18-cyclohexyl-8-oxa-3,11-diazatetracyclo[9.7.0.02,7.012,17]octadeca-1(18),2(7),3,5,12(17),13,15-heptaene-14-carbonyl)amino]cyclopentanecarbonyl]amino]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(NC(=O)C2(NC(=O)c3ccc4c(C5CCCCC5)c5n(c4c3)CCOc3cccnc3-5)CCCC2)cc1 |
| InChI | InChI=1S/C37H38N4O5/c42-31(43)17-12-24-10-14-27(15-11-24)39-36(45)37(18-4-5-19-37)40-35(44)26-13-16-28-29(23-26)41-21-22-46-30-9-6-20-38-33(30)34(41)32(28)25-7-2-1-3-8-25/h6,9-17,20,23,25H,1-5,7-8,18-19,21-22H2,(H,39,45)(H,40,44)(H,42,43)/b17-12+ |
| InChIKey | MMXDIAOEHHXLMZ-SFQUDFHCSA-N |
| XLogP | 6.92 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.73 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|