C24H31N3O3 — CID 117071312
10,11-dimethyl-8-(2-morpholin-4-ylethyl)-4-phenyl-4,8-diazatricyclo[5.3.2.02,6]dodec-11-ene-3,5-dione (PubChem CID 117071312) has the molecular formula C24H31N3O3 and a molecular weight of 409.53 g/mol. Its IUPAC name is 10,11-dimethyl-8-(2-morpholin-4-ylethyl)-4-phenyl-4,8-diazatricyclo[5.3.2.02,6]dodec-11-ene-3,5-dione.
| Compound Name | 10,11-dimethyl-8-(2-morpholin-4-ylethyl)-4-phenyl-4,8-diazatricyclo[5.3.2.02,6]dodec-11-ene-3,5-dione |
|---|---|
| PubChem CID | 117071312 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | 10,11-dimethyl-8-(2-morpholin-4-ylethyl)-4-phenyl-4,8-diazatricyclo[5.3.2.02,6]dodec-11-ene-3,5-dione |
| SMILES | CC1=CC2C3C(=O)N(c4ccccc4)C(=O)C3C1C(C)CN2CCN1CCOCC1 |
| InChI | InChI=1S/C24H31N3O3/c1-16-14-19-21-22(24(29)27(23(21)28)18-6-4-3-5-7-18)20(16)17(2)15-26(19)9-8-25-10-12-30-13-11-25/h3-7,14,17,19-22H,8-13,15H2,1-2H3 |
| InChIKey | JKNWJMVEYJJIKM-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|