C19H17N3O3S — CID 117071560
2-[2-[(2E)-2-(2,3-dihydrochromen-4-ylidene)hydrazinyl]-1,3-thiazol-4-yl]-5-methoxyphenol (PubChem CID 117071560) has the molecular formula C19H17N3O3S and a molecular weight of 367.43 g/mol. Its IUPAC name is 2-[2-[(2E)-2-(2,3-dihydrochromen-4-ylidene)hydrazinyl]-1,3-thiazol-4-yl]-5-methoxyphenol.
| Compound Name | 2-[2-[(2E)-2-(2,3-dihydrochromen-4-ylidene)hydrazinyl]-1,3-thiazol-4-yl]-5-methoxyphenol |
|---|---|
| PubChem CID | 117071560 |
| Molecular Formula | C19H17N3O3S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | 2-[2-[(2E)-2-(2,3-dihydrochromen-4-ylidene)hydrazinyl]-1,3-thiazol-4-yl]-5-methoxyphenol |
| SMILES | COc1ccc(-c2csc(N/N=C3\CCOc4ccccc43)n2)c(O)c1 |
| InChI | InChI=1S/C19H17N3O3S/c1-24-12-6-7-13(17(23)10-12)16-11-26-19(20-16)22-21-15-8-9-25-18-5-3-2-4-14(15)18/h2-7,10-11,23H,8-9H2,1H3,(H,20,22)/b21-15+ |
| InChIKey | UWGXRKSCWPTACO-RCCKNPSSSA-N |
| XLogP | 4.12 |
| TPSA | 75.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|