C22H28NO+ — CID 117071974
[1-phenyl-4-[(E)-3-phenylprop-2-enoxy]cyclohexyl]methylazanium (PubChem CID 117071974) has the molecular formula C22H28NO+ and a molecular weight of 322.47 g/mol. Its IUPAC name is [1-phenyl-4-[(E)-3-phenylprop-2-enoxy]cyclohexyl]methylazanium.
| Compound Name | [1-phenyl-4-[(E)-3-phenylprop-2-enoxy]cyclohexyl]methylazanium |
|---|---|
| PubChem CID | 117071974 |
| Molecular Formula | C22H28NO+ |
| Molecular Weight | 322.47 g/mol |
| Exact Mass | 322.22 |
| IUPAC Name | [1-phenyl-4-[(E)-3-phenylprop-2-enoxy]cyclohexyl]methylazanium |
| SMILES | [NH3+]C[C@]1(c2ccccc2)CC[C@@H](OC/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C22H27NO/c23-18-22(20-11-5-2-6-12-20)15-13-21(14-16-22)24-17-7-10-19-8-3-1-4-9-19/h1-12,21H,13-18,23H2/p+1/b10-7+/t21-,22+ |
| InChIKey | JACSEOHFDRDIAI-KRZFAFBLSA-O |
| XLogP | 3.84 |
| TPSA | 36.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.47 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |