C21H22O2 — CID 117072133
(2E,4E,6Z)-3,7-dimethyl-8-(7-methylnaphthalen-1-yl)octa-2,4,6-trienoic acid (PubChem CID 117072133) has the molecular formula C21H22O2 and a molecular weight of 306.41 g/mol. Its IUPAC name is (2E,4E,6Z)-3,7-dimethyl-8-(7-methylnaphthalen-1-yl)octa-2,4,6-trienoic acid.
| Compound Name | (2E,4E,6Z)-3,7-dimethyl-8-(7-methylnaphthalen-1-yl)octa-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 117072133 |
| Molecular Formula | C21H22O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | (2E,4E,6Z)-3,7-dimethyl-8-(7-methylnaphthalen-1-yl)octa-2,4,6-trienoic acid |
| SMILES | C/C(=C/C=C/C(C)=C/C(=O)O)Cc1cccc2ccc(C)cc12 |
| InChI | InChI=1S/C21H22O2/c1-15(6-4-7-16(2)14-21(22)23)12-19-9-5-8-18-11-10-17(3)13-20(18)19/h4-11,13-14H,12H2,1-3H3,(H,22,23)/b7-4+,15-6-,16-14+ |
| InChIKey | KKKSGJQCQBYFEU-JJONVLJJSA-N |
| XLogP | 5.22 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|