C22H22N5O2+ — CID 117072206
12-[4-(4-methylpiperazin-4-ium-1-yl)phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carboxylic acid (PubChem CID 117072206) has the molecular formula C22H22N5O2+ and a molecular weight of 388.45 g/mol. Its IUPAC name is 12-[4-(4-methylpiperazin-4-ium-1-yl)phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carboxylic acid.
| Compound Name | 12-[4-(4-methylpiperazin-4-ium-1-yl)phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carboxylic acid |
|---|---|
| PubChem CID | 117072206 |
| Molecular Formula | C22H22N5O2+ |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 12-[4-(4-methylpiperazin-4-ium-1-yl)phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carboxylic acid |
| SMILES | C[NH+]1CCN(c2ccc(-c3cnc4[nH]c5cnc(C(=O)O)cc5c4c3)cc2)CC1 |
| InChI | InChI=1S/C22H21N5O2/c1-26-6-8-27(9-7-26)16-4-2-14(3-5-16)15-10-18-17-11-19(22(28)29)23-13-20(17)25-21(18)24-12-15/h2-5,10-13H,6-9H2,1H3,(H,24,25)(H,28,29)/p+1 |
| InChIKey | AVGXCPYDUVBUKP-UHFFFAOYSA-O |
| XLogP | 1.81 |
| TPSA | 86.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |