About 3-(benzenesulfonamido)-5-(3,5-dimethyl-1,2-oxazol-4-yl)benzoic acid
3-(benzenesulfonamido)-5-(3,5-dimethyl-1,2-oxazol-4-yl)benzoic acid (PubChem CID 117072250) has the molecular formula C18H16N2O5S
and a molecular weight of 372.40 g/mol. Its IUPAC name is 3-(benzenesulfonamido)-5-(3,5-dimethyl-1,2-oxazol-4-yl)benzoic acid.
Molecular Properties
| Compound Name | 3-(benzenesulfonamido)-5-(3,5-dimethyl-1,2-oxazol-4-yl)benzoic acid |
| PubChem CID | 117072250 |
| Molecular Formula | C18H16N2O5S |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | 3-(benzenesulfonamido)-5-(3,5-dimethyl-1,2-oxazol-4-yl)benzoic acid |
| SMILES | Cc1noc(C)c1-c1cc(NS(=O)(=O)c2ccccc2)cc(C(=O)O)c1 |
| InChI | InChI=1S/C18H16N2O5S/c1-11-17(12(2)25-19-11)13-8-14(18(21)22)10-15(9-13)20-26(23,24)16-6-4-3-5-7-16/h3-10,20H,1-2H3,(H,21,22) |
| InChIKey | FFWKFJNEMDSJKS-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(benzenesulfonamido)-5-(3,5-dimethyl-1,2-oxazol-4-yl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(benzenesulfonamido)-5-(3,5-dimethyl-1,2-oxazol-4-yl)benzoic acid?
The IUPAC name of 3-(benzenesulfonamido)-5-(3,5-dimethyl-1,2-oxazol-4-yl)benzoic acid (CID 117072250) is 3-(benzenesulfonamido)-5-(3,5-dimethyl-1,2-oxazol-4-yl)benzoic acid.
What is the SMILES notation for 3-(benzenesulfonamido)-5-(3,5-dimethyl-1,2-oxazol-4-yl)benzoic acid?
The canonical SMILES for 3-(benzenesulfonamido)-5-(3,5-dimethyl-1,2-oxazol-4-yl)benzoic acid is Cc1noc(C)c1-c1cc(NS(=O)(=O)c2ccccc2)cc(C(=O)O)c1.
What is the InChIKey of 3-(benzenesulfonamido)-5-(3,5-dimethyl-1,2-oxazol-4-yl)benzoic acid?
The InChIKey is FFWKFJNEMDSJKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N2O5S/c1-11-17(12(2)25-19-11)13-8-14(18(21)22)10-15(9-13)20-26(23,24)16-6-4-3-5-7-16/h3-10,20H,1-2H3,(H,21,22).
What are the key properties of 3-(benzenesulfonamido)-5-(3,5-dimethyl-1,2-oxazol-4-yl)benzoic acid?
3-(benzenesulfonamido)-5-(3,5-dimethyl-1,2-oxazol-4-yl)benzoic acid has a molecular weight of 372.40 g/mol, XLogP of 3.46, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(benzenesulfonamido)-5-(3,5-dimethyl-1,2-oxazol-4-yl)benzoic acid is sourced from PubChem (CID 117072250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).